C17H24N2O — CID 134926302
(3R)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,3'-piperidine] (PubChem CID 134926302) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (3R)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,3'-piperidine].
| Compound Name | (3R)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,3'-piperidine] |
|---|---|
| PubChem CID | 134926302 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (3R)-3-phenylspiro[2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-5,3'-piperidine] |
| SMILES | c1ccc([C@@H]2COC3CCCC4(CCCNC4)N32)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-2-6-14(7-3-1)15-12-20-16-8-4-9-17(19(15)16)10-5-11-18-13-17/h1-3,6-7,15-16,18H,4-5,8-13H2/t15-,16?,17?/m0/s1 |
| InChIKey | MMQSHCNGTHKFEW-GTPINHCMSA-N |
| XLogP | 2.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |