C17H24O2 — CID 134929847
2-[(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-2,5,5-trimethylcyclohexane-1,3-dione (PubChem CID 134929847) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-2,5,5-trimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-2,5,5-trimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 134929847 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-[(3aS,6aS)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-2,5,5-trimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C)(C2=C[C@H]3CCC[C@H]3C2)C(=O)C1 |
| InChI | InChI=1S/C17H24O2/c1-16(2)9-14(18)17(3,15(19)10-16)13-7-11-5-4-6-12(11)8-13/h7,11-12H,4-6,8-10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | LRYIHAQGDQKOAD-NEPJUHHUSA-N |
| XLogP | 3.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|