C23H28O2S — CID 134932201
2-[(Z)-5-[(R)-(4-methylphenyl)sulfinyl]-4-phenylpent-4-enyl]oxane (PubChem CID 134932201) has the molecular formula C23H28O2S and a molecular weight of 368.54 g/mol. Its IUPAC name is 2-[(Z)-5-[(R)-(4-methylphenyl)sulfinyl]-4-phenylpent-4-enyl]oxane.
| Compound Name | 2-[(Z)-5-[(R)-(4-methylphenyl)sulfinyl]-4-phenylpent-4-enyl]oxane |
|---|---|
| PubChem CID | 134932201 |
| Molecular Formula | C23H28O2S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[(Z)-5-[(R)-(4-methylphenyl)sulfinyl]-4-phenylpent-4-enyl]oxane |
| SMILES | Cc1ccc([S@](=O)/C=C(/CCCC2CCCCO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H28O2S/c1-19-13-15-23(16-14-19)26(24)18-21(20-8-3-2-4-9-20)10-7-12-22-11-5-6-17-25-22/h2-4,8-9,13-16,18,22H,5-7,10-12,17H2,1H3/b21-18-/t22?,26-/m1/s1 |
| InChIKey | BJFYHXCSUKKNLL-JIYKQTFESA-N |
| XLogP | 5.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |