C22H23NO3 — CID 134933309
benzyl 6-[(Z)-1-methoxy-2-phenylethenyl]-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134933309) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is benzyl 6-[(Z)-1-methoxy-2-phenylethenyl]-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl 6-[(Z)-1-methoxy-2-phenylethenyl]-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134933309 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | benzyl 6-[(Z)-1-methoxy-2-phenylethenyl]-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CO/C(=C\c1ccccc1)C1=CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-25-21(16-18-10-4-2-5-11-18)20-14-8-9-15-23(20)22(24)26-17-19-12-6-3-7-13-19/h2-7,10-14,16H,8-9,15,17H2,1H3/b21-16- |
| InChIKey | MOGJMOHKDPYJCJ-PGMHBOJBSA-N |
| XLogP | 4.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|