C14H7NO — CID 134937250
(2E)-2-(2-oxoacenaphthylen-1-ylidene)acetonitrile (PubChem CID 134937250) has the molecular formula C14H7NO and a molecular weight of 205.22 g/mol. Its IUPAC name is (2E)-2-(2-oxoacenaphthylen-1-ylidene)acetonitrile.
| Compound Name | (2E)-2-(2-oxoacenaphthylen-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 134937250 |
| Molecular Formula | C14H7NO |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (2E)-2-(2-oxoacenaphthylen-1-ylidene)acetonitrile |
| SMILES | N#C/C=c1/c(=O)c2cccc3cccc1c32 |
| InChI | InChI=1S/C14H7NO/c15-8-7-11-10-5-1-3-9-4-2-6-12(13(9)10)14(11)16/h1-7H/b11-7+ |
| InChIKey | VPCQSNNIEGVIHF-YRNVUSSQSA-N |
| XLogP | 1.81 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |