C14H26O3S2 — CID 134937719
ethyl 2-[(1R)-1-hydroxyoctyl]-1,3-dithiolane-2-carboxylate (PubChem CID 134937719) has the molecular formula C14H26O3S2 and a molecular weight of 306.49 g/mol. Its IUPAC name is ethyl 2-[(1R)-1-hydroxyoctyl]-1,3-dithiolane-2-carboxylate.
| Compound Name | ethyl 2-[(1R)-1-hydroxyoctyl]-1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 134937719 |
| Molecular Formula | C14H26O3S2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | ethyl 2-[(1R)-1-hydroxyoctyl]-1,3-dithiolane-2-carboxylate |
| SMILES | CCCCCCC[C@@H](O)C1(C(=O)OCC)SCCS1 |
| InChI | InChI=1S/C14H26O3S2/c1-3-5-6-7-8-9-12(15)14(13(16)17-4-2)18-10-11-19-14/h12,15H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | YNWFLUKLMFHDPR-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|