C19H32O4SSi — CID 134937813
1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy-tri(propan-2-yl)silane (PubChem CID 134937813) has the molecular formula C19H32O4SSi and a molecular weight of 384.61 g/mol. Its IUPAC name is 1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy-tri(propan-2-yl)silane.
| Compound Name | 1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134937813 |
| Molecular Formula | C19H32O4SSi |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]ethoxy-tri(propan-2-yl)silane |
| SMILES | CC(O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H32O4SSi/c1-13(2)25(14(3)4,15(5)6)23-16(7)18-19(22-18)24(20,21)17-11-9-8-10-12-17/h8-16,18-19H,1-7H3/t16?,18-,19-/m1/s1 |
| InChIKey | KQDRHNFRTUJBKX-VOBHOPKGSA-N |
| XLogP | 4.77 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|