C43H43NO5 — CID 134939011
3-[17-[(4-methylphenyl)methyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]propyl (E,5R,6S)-6-methoxy-5-methyl-6-phenylhex-3-enoate (PubChem CID 134939011) has the molecular formula C43H43NO5 and a molecular weight of 653.82 g/mol. Its IUPAC name is 3-[17-[(4-methylphenyl)methyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]propyl (E,5R,6S)-6-methoxy-5-methyl-6-phenylhex-3-enoate.
| Compound Name | 3-[17-[(4-methylphenyl)methyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]propyl (E,5R,6S)-6-methoxy-5-methyl-6-phenylhex-3-enoate |
|---|---|
| PubChem CID | 134939011 |
| Molecular Formula | C43H43NO5 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | 3-[17-[(4-methylphenyl)methyl]-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]propyl (E,5R,6S)-6-methoxy-5-methyl-6-phenylhex-3-enoate |
| SMILES | CO[C@H](c1ccccc1)[C@H](C)/C=C/CC(=O)OCCCC12c3ccccc3C(c3ccccc31)C1C(=O)N(Cc3ccc(C)cc3)C(=O)C12 |
| InChI | InChI=1S/C43H43NO5/c1-28-21-23-30(24-22-28)27-44-41(46)38-37-32-16-7-9-18-34(32)43(39(38)42(44)47,35-19-10-8-17-33(35)37)25-12-26-49-36(45)20-11-13-29(2)40(48-3)31-14-5-4-6-15-31/h4-11,13-19,21-24,29,37-40H,12,20,25-27H2,1-3H3/b13-11+/t29-,37?,38?,39?,40+,43?/m1/s1 |
| InChIKey | OOPOMDNGDIRIBJ-FQCVLCJLSA-N |
| XLogP | 7.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|