C21H28O3 — CID 134939694
ethyl (4R,5R,8R)-2,9-bis(ethenyl)-5-methyl-13-oxotetracyclo[7.4.0.02,11.04,8]tridecane-1-carboxylate (PubChem CID 134939694) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is ethyl (4R,5R,8R)-2,9-bis(ethenyl)-5-methyl-13-oxotetracyclo[7.4.0.02,11.04,8]tridecane-1-carboxylate.
| Compound Name | ethyl (4R,5R,8R)-2,9-bis(ethenyl)-5-methyl-13-oxotetracyclo[7.4.0.02,11.04,8]tridecane-1-carboxylate |
|---|---|
| PubChem CID | 134939694 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | ethyl (4R,5R,8R)-2,9-bis(ethenyl)-5-methyl-13-oxotetracyclo[7.4.0.02,11.04,8]tridecane-1-carboxylate |
| SMILES | C=CC12C[C@@H]3[C@H](C)CC[C@H]3C3(C=C)CC1CC(=O)C23C(=O)OCC |
| InChI | InChI=1S/C21H28O3/c1-5-19-12-15-13(4)8-9-16(15)20(6-2)11-14(19)10-17(22)21(19,20)18(23)24-7-3/h5-6,13-16H,1-2,7-12H2,3-4H3/t13-,14?,15-,16-,19?,20?,21?/m1/s1 |
| InChIKey | MFHKQYUQQCKYHP-MRDQKCPDSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|