C24H24O2S2 — CID 134940384
S-phenyl (2S,3R)-3-hydroxy-5-phenyl-2-(phenylsulfanylmethyl)pentanethioate (PubChem CID 134940384) has the molecular formula C24H24O2S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-hydroxy-5-phenyl-2-(phenylsulfanylmethyl)pentanethioate.
| Compound Name | S-phenyl (2S,3R)-3-hydroxy-5-phenyl-2-(phenylsulfanylmethyl)pentanethioate |
|---|---|
| PubChem CID | 134940384 |
| Molecular Formula | C24H24O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | S-phenyl (2S,3R)-3-hydroxy-5-phenyl-2-(phenylsulfanylmethyl)pentanethioate |
| SMILES | O=C(Sc1ccccc1)[C@H](CSc1ccccc1)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C24H24O2S2/c25-23(17-16-19-10-4-1-5-11-19)22(18-27-20-12-6-2-7-13-20)24(26)28-21-14-8-3-9-15-21/h1-15,22-23,25H,16-18H2/t22-,23-/m1/s1 |
| InChIKey | WFRWWOXGZLYNOK-DHIUTWEWSA-N |
| XLogP | 5.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|