C23H50O4Si2 — CID 134940447
(2R,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxyundecan-5-one (PubChem CID 134940447) has the molecular formula C23H50O4Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is (2R,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxyundecan-5-one.
| Compound Name | (2R,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxyundecan-5-one |
|---|---|
| PubChem CID | 134940447 |
| Molecular Formula | C23H50O4Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (2R,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxyundecan-5-one |
| SMILES | C[C@H](CCC(=O)CCC[C@@H](CCO)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O4Si2/c1-19(26-28(8,9)22(2,3)4)15-16-20(25)13-12-14-21(17-18-24)27-29(10,11)23(5,6)7/h19,21,24H,12-18H2,1-11H3/t19-,21+/m1/s1 |
| InChIKey | UVUVVWMPMBWXLB-CTNGQTDRSA-N |
| XLogP | 6.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|