C23H50O4Si2 — CID 134940448
2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1-[(3R)-3-hydroxybutyl]cyclopropan-1-ol (PubChem CID 134940448) has the molecular formula C23H50O4Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is 2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1-[(3R)-3-hydroxybutyl]cyclopropan-1-ol.
| Compound Name | 2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1-[(3R)-3-hydroxybutyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 134940448 |
| Molecular Formula | C23H50O4Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 2-[(2S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-1-[(3R)-3-hydroxybutyl]cyclopropan-1-ol |
| SMILES | C[C@@H](O)CCC1(O)CC1C[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H50O4Si2/c1-18(24)12-14-23(25)17-19(23)16-20(27-29(10,11)22(5,6)7)13-15-26-28(8,9)21(2,3)4/h18-20,24-25H,12-17H2,1-11H3/t18-,19?,20-,23?/m1/s1 |
| InChIKey | YSZMRSMLUWOXOB-TVJQWHPQSA-N |
| XLogP | 6.09 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|