C20H26O4 — CID 134940871
methyl 3-[(3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]-3-methylbutanoate (PubChem CID 134940871) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is methyl 3-[(3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]-3-methylbutanoate.
| Compound Name | methyl 3-[(3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 134940871 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | methyl 3-[(3R)-3-ethenyl-4-oxo-3-phenylmethoxycyclopentyl]-3-methylbutanoate |
| SMILES | C=C[C@]1(OCc2ccccc2)CC(C(C)(C)CC(=O)OC)CC1=O |
| InChI | InChI=1S/C20H26O4/c1-5-20(24-14-15-9-7-6-8-10-15)12-16(11-17(20)21)19(2,3)13-18(22)23-4/h5-10,16H,1,11-14H2,2-4H3/t16?,20-/m0/s1 |
| InChIKey | HKRPCFLIJCUYIV-FZCLLLDFSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|