C19H22O3 — CID 134940872
(3aS,5R,6aR)-5-ethenyl-3,3-dimethyl-5-phenylmethoxy-2,3a,4,6a-tetrahydropentalene-1,6-dione (PubChem CID 134940872) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3aS,5R,6aR)-5-ethenyl-3,3-dimethyl-5-phenylmethoxy-2,3a,4,6a-tetrahydropentalene-1,6-dione.
| Compound Name | (3aS,5R,6aR)-5-ethenyl-3,3-dimethyl-5-phenylmethoxy-2,3a,4,6a-tetrahydropentalene-1,6-dione |
|---|---|
| PubChem CID | 134940872 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3aS,5R,6aR)-5-ethenyl-3,3-dimethyl-5-phenylmethoxy-2,3a,4,6a-tetrahydropentalene-1,6-dione |
| SMILES | C=C[C@]1(OCc2ccccc2)C[C@H]2[C@H](C(=O)CC2(C)C)C1=O |
| InChI | InChI=1S/C19H22O3/c1-4-19(22-12-13-8-6-5-7-9-13)10-14-16(17(19)21)15(20)11-18(14,2)3/h4-9,14,16H,1,10-12H2,2-3H3/t14-,16+,19-/m0/s1 |
| InChIKey | OWPPEXDZLLPBPI-GMBSWORKSA-N |
| XLogP | 3.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|