C18H30O4 — CID 134940910
tert-butyl (1R)-1-[(1S)-1-ethoxy-3-methylbut-2-enyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 134940910) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is tert-butyl (1R)-1-[(1S)-1-ethoxy-3-methylbut-2-enyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | tert-butyl (1R)-1-[(1S)-1-ethoxy-3-methylbut-2-enyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134940910 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | tert-butyl (1R)-1-[(1S)-1-ethoxy-3-methylbut-2-enyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | CCO[C@@H](C=C(C)C)[C@]1(C(=O)OC(C)(C)C)CCCCC1=O |
| InChI | InChI=1S/C18H30O4/c1-7-21-15(12-13(2)3)18(11-9-8-10-14(18)19)16(20)22-17(4,5)6/h12,15H,7-11H2,1-6H3/t15-,18-/m0/s1 |
| InChIKey | WWINJFSOWJGIFK-YJBOKZPZSA-N |
| XLogP | 3.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|