C33H46O4Si — CID 134941910
[(3E,5Z)-3,5-bis(methoxymethoxymethyl)-4,6-diphenylhexa-3,5-dien-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 134941910) has the molecular formula C33H46O4Si and a molecular weight of 534.81 g/mol. Its IUPAC name is [(3E,5Z)-3,5-bis(methoxymethoxymethyl)-4,6-diphenylhexa-3,5-dien-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3E,5Z)-3,5-bis(methoxymethoxymethyl)-4,6-diphenylhexa-3,5-dien-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134941910 |
| Molecular Formula | C33H46O4Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | [(3E,5Z)-3,5-bis(methoxymethoxymethyl)-4,6-diphenylhexa-3,5-dien-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | COCOCC(=C\c1ccccc1)/C(=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)COCOC)c1ccccc1 |
| InChI | InChI=1S/C33H46O4Si/c1-26(2)38(27(3)4,28(5)6)20-19-31(22-36-24-34-7)33(30-17-13-10-14-18-30)32(23-37-25-35-8)21-29-15-11-9-12-16-29/h9-18,21,26-28H,22-25H2,1-8H3/b32-21+,33-31+ |
| InChIKey | PYAZGUOZYUFVKR-AXIPGRPQSA-N |
| XLogP | 7.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|