C24H40O3S2Si — CID 134942541
(4R)-1-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-1,3-dithian-2-yl]-4-hydroxyhexan-2-one (PubChem CID 134942541) has the molecular formula C24H40O3S2Si and a molecular weight of 468.80 g/mol. Its IUPAC name is (4R)-1-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-1,3-dithian-2-yl]-4-hydroxyhexan-2-one.
| Compound Name | (4R)-1-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-1,3-dithian-2-yl]-4-hydroxyhexan-2-one |
|---|---|
| PubChem CID | 134942541 |
| Molecular Formula | C24H40O3S2Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (4R)-1-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-1,3-dithian-2-yl]-4-hydroxyhexan-2-one |
| SMILES | CC[C@@H](O)CC(=O)CC1(CCc2ccc(O[Si](C)(C)C(C)(C)C)cc2)SCCCS1 |
| InChI | InChI=1S/C24H40O3S2Si/c1-7-20(25)17-21(26)18-24(28-15-8-16-29-24)14-13-19-9-11-22(12-10-19)27-30(5,6)23(2,3)4/h9-12,20,25H,7-8,13-18H2,1-6H3/t20-/m1/s1 |
| InChIKey | MQTMTVUAGJPBQL-HXUWFJFHSA-N |
| XLogP | 6.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|