C38H70O4S2Si2 — CID 24755108
tert-butyl 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanoate (PubChem CID 24755108) has the molecular formula C38H70O4S2Si2 and a molecular weight of 711.28 g/mol. Its IUPAC name is tert-butyl 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanoate.
| Compound Name | tert-butyl 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanoate |
|---|---|
| PubChem CID | 24755108 |
| Molecular Formula | C38H70O4S2Si2 |
| Molecular Weight | 711.28 g/mol |
| Exact Mass | 710.43 |
| IUPAC Name | tert-butyl 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanoate |
| SMILES | CCC[Si](CCC)(CCC)Oc1ccc(CCC2(CC(CC(=O)OC(C)(C)C)O[Si](CCC)(CCC)CCC)SCCCS2)cc1 |
| InChI | InChI=1S/C38H70O4S2Si2/c1-10-25-45(26-11-2,27-12-3)41-34-19-17-33(18-20-34)21-22-38(43-23-16-24-44-38)32-35(31-36(39)40-37(7,8)9)42-46(28-13-4,29-14-5)30-15-6/h17-20,35H,10-16,21-32H2,1-9H3 |
| InChIKey | UVMZSOUINOPPPO-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.28 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|