C34H62O3S2Si2 — CID 135013214
3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanal (PubChem CID 135013214) has the molecular formula C34H62O3S2Si2 and a molecular weight of 639.17 g/mol. Its IUPAC name is 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanal.
| Compound Name | 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanal |
|---|---|
| PubChem CID | 135013214 |
| Molecular Formula | C34H62O3S2Si2 |
| Molecular Weight | 639.17 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 3-tripropylsilyloxy-4-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]butanal |
| SMILES | CCC[Si](CCC)(CCC)Oc1ccc(CCC2(CC(CC=O)O[Si](CCC)(CCC)CCC)SCCCS2)cc1 |
| InChI | InChI=1S/C34H62O3S2Si2/c1-7-24-40(25-8-2,26-9-3)36-32-16-14-31(15-17-32)18-20-34(38-22-13-23-39-34)30-33(19-21-35)37-41(27-10-4,28-11-5)29-12-6/h14-17,21,33H,7-13,18-20,22-30H2,1-6H3 |
| InChIKey | VKASVZIWIWLUJI-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.17 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|