C37H66O3S2Si2 — CID 135013055
(E,6R)-6-tripropylsilyloxy-7-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]hept-3-en-2-one (PubChem CID 135013055) has the molecular formula C37H66O3S2Si2 and a molecular weight of 679.24 g/mol. Its IUPAC name is (E,6R)-6-tripropylsilyloxy-7-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]hept-3-en-2-one.
| Compound Name | (E,6R)-6-tripropylsilyloxy-7-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]hept-3-en-2-one |
|---|---|
| PubChem CID | 135013055 |
| Molecular Formula | C37H66O3S2Si2 |
| Molecular Weight | 679.24 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | (E,6R)-6-tripropylsilyloxy-7-[2-[2-(4-tripropylsilyloxyphenyl)ethyl]-1,3-dithian-2-yl]hept-3-en-2-one |
| SMILES | CCC[Si](CCC)(CCC)Oc1ccc(CCC2(C[C@@H](C/C=C/C(C)=O)O[Si](CCC)(CCC)CCC)SCCCS2)cc1 |
| InChI | InChI=1S/C37H66O3S2Si2/c1-8-26-43(27-9-2,28-10-3)39-35-20-18-34(19-21-35)22-23-37(41-24-15-25-42-37)32-36(17-14-16-33(7)38)40-44(29-11-4,30-12-5)31-13-6/h14,16,18-21,36H,8-13,15,17,22-32H2,1-7H3/b16-14+/t36-/m1/s1 |
| InChIKey | FLXFYGLMLXWWAK-DTOARXMZSA-N |
| XLogP | 12.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.24 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|