C30H47O3P — CID 134942779
ethyl (1R,3aR,6aS)-3-oxo-2-[phenyl-(tributyl-λ5-phosphanylidene)methyl]-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate (PubChem CID 134942779) has the molecular formula C30H47O3P and a molecular weight of 486.68 g/mol. Its IUPAC name is ethyl (1R,3aR,6aS)-3-oxo-2-[phenyl-(tributyl-λ5-phosphanylidene)methyl]-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate.
| Compound Name | ethyl (1R,3aR,6aS)-3-oxo-2-[phenyl-(tributyl-λ5-phosphanylidene)methyl]-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 134942779 |
| Molecular Formula | C30H47O3P |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | ethyl (1R,3aR,6aS)-3-oxo-2-[phenyl-(tributyl-λ5-phosphanylidene)methyl]-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
| SMILES | CCCCP(CCCC)(CCCC)=C(c1ccccc1)C1C(=O)[C@@H]2CCC[C@@H]2[C@H]1C(=O)OCC |
| InChI | InChI=1S/C30H47O3P/c1-5-9-20-34(21-10-6-2,22-11-7-3)29(23-16-13-12-14-17-23)27-26(30(32)33-8-4)24-18-15-19-25(24)28(27)31/h12-14,16-17,24-27H,5-11,15,18-22H2,1-4H3/t24-,25+,26+,27?/m0/s1 |
| InChIKey | LESDFKMFZULQMG-MTIUMXNOSA-N |
| XLogP | 7.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|