C16H17FO4 — CID 177429659
ethyl 2-[(1S,2R,3S)-3-(4-fluorophenyl)-2-formyl-5-oxocyclopentyl]acetate (PubChem CID 177429659) has the molecular formula C16H17FO4 and a molecular weight of 292.31 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,3S)-3-(4-fluorophenyl)-2-formyl-5-oxocyclopentyl]acetate.
| Compound Name | ethyl 2-[(1S,2R,3S)-3-(4-fluorophenyl)-2-formyl-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 177429659 |
| Molecular Formula | C16H17FO4 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl 2-[(1S,2R,3S)-3-(4-fluorophenyl)-2-formyl-5-oxocyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C(=O)C[C@H](c2ccc(F)cc2)[C@H]1C=O |
| InChI | InChI=1S/C16H17FO4/c1-2-21-16(20)8-13-14(9-18)12(7-15(13)19)10-3-5-11(17)6-4-10/h3-6,9,12-14H,2,7-8H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | ISCSFZMEFPLUBW-HZSPNIEDSA-N |
| XLogP | 2.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|