C14H21ClN2O2RuS — CID 134945731
[(1S,2S)-2-azanidylcyclohexyl]-(4-methylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+) (PubChem CID 134945731) has the molecular formula C14H21ClN2O2RuS and a molecular weight of 417.92 g/mol. Its IUPAC name is [(1S,2S)-2-azanidylcyclohexyl]-(4-methylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+).
| Compound Name | [(1S,2S)-2-azanidylcyclohexyl]-(4-methylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 134945731 |
| Molecular Formula | C14H21ClN2O2RuS |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | [(1S,2S)-2-azanidylcyclohexyl]-(4-methylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+) |
| SMILES | Cc1ccc(S(=O)(=O)[N-][C@H]2CCCC[C@@H]2[NH-])cc1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C13H18N2O2S.CH3.ClH.Ru/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14;;;/h6-9,12-14H,2-5H2,1H3;1H3;1H;/q-2;-1;;+4/p-1/t12-,13-;;;/m0.../s1 |
| InChIKey | MNJDHZWQGCAGHN-SQWZUNHGSA-M |
| XLogP | 4.56 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|