C23H34ClN2O2RhS+ — CID 10506627
CID 10506627 (PubChem CID 10506627) has the molecular formula C23H34ClN2O2RhS+ and a molecular weight of 540.96 g/mol.
| Compound Name | CID 10506627 |
|---|---|
| PubChem CID | 10506627 |
| Molecular Formula | C23H34ClN2O2RhS+ |
| Molecular Weight | 540.96 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C](C)[C]1C.Cc1ccc(S(=O)(=O)[N-][C@@H]2CCCC[C@H]2N)cc1.Cl[Rh+2] |
| InChI | InChI=1S/C13H19N2O2S.C10H15.ClH.Rh/c1-10-6-8-11(9-7-10)18(16,17)15-13-5-3-2-4-12(13)14;1-6-7(2)9(4)10(5)8(6)3;;/h6-9,12-13H,2-5,14H2,1H3;1-5H3;1H;/q-1;;;+3/p-1/t12-,13-;;;/m1.../s1 |
| InChIKey | IALCCONWPWPIDY-GPWCTTBFSA-M |
| XLogP | 5.99 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.96 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |