C21H31N — CID 134945805
(1R,3S,8aR)-2-benzyl-3,4-diethyl-1-methyl-3,5,6,7,8,8a-hexahydro-1H-isoquinoline (PubChem CID 134945805) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (1R,3S,8aR)-2-benzyl-3,4-diethyl-1-methyl-3,5,6,7,8,8a-hexahydro-1H-isoquinoline.
| Compound Name | (1R,3S,8aR)-2-benzyl-3,4-diethyl-1-methyl-3,5,6,7,8,8a-hexahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 134945805 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (1R,3S,8aR)-2-benzyl-3,4-diethyl-1-methyl-3,5,6,7,8,8a-hexahydro-1H-isoquinoline |
| SMILES | CCC1=C2CCCC[C@H]2[C@@H](C)N(Cc2ccccc2)[C@H]1CC |
| InChI | InChI=1S/C21H31N/c1-4-18-20-14-10-9-13-19(20)16(3)22(21(18)5-2)15-17-11-7-6-8-12-17/h6-8,11-12,16,19,21H,4-5,9-10,13-15H2,1-3H3/t16-,19+,21+/m1/s1 |
| InChIKey | ABIPXTWBOYVVJX-PBEJRMEISA-N |
| XLogP | 5.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|