C35H35N3O6 — CID 134947794
15-O,15-O'-dimethyl 10-O-phenyl (1S,9S,13S)-13-(1,3-dimethylindol-2-yl)-8-methyl-8,10-diazatetracyclo[7.3.3.01,9.02,7]pentadeca-2,4,6-triene-10,15,15-tricarboxylate (PubChem CID 134947794) has the molecular formula C35H35N3O6 and a molecular weight of 593.68 g/mol. Its IUPAC name is 15-O,15-O'-dimethyl 10-O-phenyl (1S,9S,13S)-13-(1,3-dimethylindol-2-yl)-8-methyl-8,10-diazatetracyclo[7.3.3.01,9.02,7]pentadeca-2,4,6-triene-10,15,15-tricarboxylate.
| Compound Name | 15-O,15-O'-dimethyl 10-O-phenyl (1S,9S,13S)-13-(1,3-dimethylindol-2-yl)-8-methyl-8,10-diazatetracyclo[7.3.3.01,9.02,7]pentadeca-2,4,6-triene-10,15,15-tricarboxylate |
|---|---|
| PubChem CID | 134947794 |
| Molecular Formula | C35H35N3O6 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | 15-O,15-O'-dimethyl 10-O-phenyl (1S,9S,13S)-13-(1,3-dimethylindol-2-yl)-8-methyl-8,10-diazatetracyclo[7.3.3.01,9.02,7]pentadeca-2,4,6-triene-10,15,15-tricarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](c2c(C)c3ccccc3n2C)[C@]23CCN(C(=O)Oc4ccccc4)[C@]12N(C)c1ccccc13 |
| InChI | InChI=1S/C35H35N3O6/c1-22-24-15-9-11-17-27(24)36(2)29(22)26-21-34(30(39)42-4,31(40)43-5)35-33(26,25-16-10-12-18-28(25)37(35)3)19-20-38(35)32(41)44-23-13-7-6-8-14-23/h6-18,26H,19-21H2,1-5H3/t26-,33-,35+/m1/s1 |
| InChIKey | UXHOZDPZVHEXDQ-WCLFVPJXSA-N |
| XLogP | 5.30 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|