C22H27NO4 — CID 11824795
dimethyl (1R,9S,14S)-14-ethenyl-8-methyl-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate (PubChem CID 11824795) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is dimethyl (1R,9S,14S)-14-ethenyl-8-methyl-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate.
| Compound Name | dimethyl (1R,9S,14S)-14-ethenyl-8-methyl-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate |
|---|---|
| PubChem CID | 11824795 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | dimethyl (1R,9S,14S)-14-ethenyl-8-methyl-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)[C@]23CCCC[C@]12c1ccccc1N3C |
| InChI | InChI=1S/C22H27NO4/c1-5-15-14-21(18(24)26-3,19(25)27-4)22-13-9-8-12-20(15,22)16-10-6-7-11-17(16)23(22)2/h5-7,10-11,15H,1,8-9,12-14H2,2-4H3/t15-,20-,22+/m1/s1 |
| InChIKey | MSHUOFIZBKYIAR-QPJICYPMSA-N |
| XLogP | 3.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|