C28H31NO4 — CID 10906392
dimethyl (1R,9S,14S)-8-methyl-14-[(E)-2-phenylethenyl]-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate (PubChem CID 10906392) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is dimethyl (1R,9S,14S)-8-methyl-14-[(E)-2-phenylethenyl]-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate.
| Compound Name | dimethyl (1R,9S,14S)-8-methyl-14-[(E)-2-phenylethenyl]-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate |
|---|---|
| PubChem CID | 10906392 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | dimethyl (1R,9S,14S)-8-methyl-14-[(E)-2-phenylethenyl]-8-azatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene-16,16-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H](/C=C/c2ccccc2)[C@@]23CCCC[C@@]12N(C)c1ccccc13 |
| InChI | InChI=1S/C28H31NO4/c1-29-23-14-8-7-13-22(23)26-17-9-10-18-28(26,29)27(24(30)32-2,25(31)33-3)19-21(26)16-15-20-11-5-4-6-12-20/h4-8,11-16,21H,9-10,17-19H2,1-3H3/b16-15+/t21-,26-,28+/m1/s1 |
| InChIKey | GAHHYNWRPSTTNR-WFERBOMTSA-N |
| XLogP | 4.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|