C20H24ClNO3S — CID 134949215
N-[(2R,3R)-2-chloro-4,4-dimethyl-1-oxo-1-phenylpentan-3-yl]-4-methylbenzenesulfonamide (PubChem CID 134949215) has the molecular formula C20H24ClNO3S and a molecular weight of 393.94 g/mol. Its IUPAC name is N-[(2R,3R)-2-chloro-4,4-dimethyl-1-oxo-1-phenylpentan-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R,3R)-2-chloro-4,4-dimethyl-1-oxo-1-phenylpentan-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134949215 |
| Molecular Formula | C20H24ClNO3S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-[(2R,3R)-2-chloro-4,4-dimethyl-1-oxo-1-phenylpentan-3-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]([C@@H](Cl)C(=O)c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H24ClNO3S/c1-14-10-12-16(13-11-14)26(24,25)22-19(20(2,3)4)17(21)18(23)15-8-6-5-7-9-15/h5-13,17,19,22H,1-4H3/t17-,19-/m0/s1 |
| InChIKey | KMHAZLOPUYRGEC-HKUYNNGSSA-N |
| XLogP | 4.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|