About benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate
benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate (PubChem CID 134952905) has the molecular formula C26H20N2O3
and a molecular weight of 408.46 g/mol. Its IUPAC name is benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate.
Molecular Properties
| Compound Name | benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate |
| PubChem CID | 134952905 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate |
| SMILES | N#C[C@@]1(C(=O)c2ccccc2)CC(C(=O)OCc2ccccc2)=C2Cn3cccc3[C@H]21 |
| InChI | InChI=1S/C26H20N2O3/c27-17-26(24(29)19-10-5-2-6-11-19)14-20(21-15-28-13-7-12-22(28)23(21)26)25(30)31-16-18-8-3-1-4-9-18/h1-13,23H,14-16H2/t23-,26-/m0/s1 |
| InChIKey | ZVCXBJKAFZCWPF-OZXSUGGESA-N |
| XLogP | 4.42 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate?
The IUPAC name of benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate (CID 134952905) is benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate.
What is the SMILES notation for benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate?
The canonical SMILES for benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate is N#C[C@@]1(C(=O)c2ccccc2)CC(C(=O)OCc2ccccc2)=C2Cn3cccc3[C@H]21.
What is the InChIKey of benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate?
The InChIKey is ZVCXBJKAFZCWPF-OZXSUGGESA-N. The full InChI is InChI=1S/C26H20N2O3/c27-17-26(24(29)19-10-5-2-6-11-19)14-20(21-15-28-13-7-12-22(28)23(21)26)25(30)31-16-18-8-3-1-4-9-18/h1-13,23H,14-16H2/t23-,26-/m0/s1.
What are the key properties of benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate?
benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate has a molecular weight of 408.46 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (8R,8aR)-8-benzoyl-8-cyano-7,8a-dihydro-5H-cyclopenta[a]pyrrolizine-6-carboxylate is sourced from PubChem (CID 134952905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).