C27H28BrNO4 — CID 122368657
benzyl (4S,5R)-4-(4-bromophenyl)-5-cyano-5-hexanoyl-2-hydroxycyclohexene-1-carboxylate (PubChem CID 122368657) has the molecular formula C27H28BrNO4 and a molecular weight of 510.43 g/mol. Its IUPAC name is benzyl (4S,5R)-4-(4-bromophenyl)-5-cyano-5-hexanoyl-2-hydroxycyclohexene-1-carboxylate.
| Compound Name | benzyl (4S,5R)-4-(4-bromophenyl)-5-cyano-5-hexanoyl-2-hydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 122368657 |
| Molecular Formula | C27H28BrNO4 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | benzyl (4S,5R)-4-(4-bromophenyl)-5-cyano-5-hexanoyl-2-hydroxycyclohexene-1-carboxylate |
| SMILES | CCCCCC(=O)[C@]1(C#N)CC(C(=O)OCc2ccccc2)=C(O)C[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H28BrNO4/c1-2-3-5-10-25(31)27(18-29)16-22(26(32)33-17-19-8-6-4-7-9-19)24(30)15-23(27)20-11-13-21(28)14-12-20/h4,6-9,11-14,23,30H,2-3,5,10,15-17H2,1H3/t23-,27-/m0/s1 |
| InChIKey | QPRXVXSPZSJDGE-HOFKKMOUSA-N |
| XLogP | 6.54 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|