C15H18INO3S — CID 134956143
(1R,5S)-1-[(Z)-2-iodoethenyl]-4,4-dimethyl-3-(4-methylphenyl)sulfonyl-6-oxa-3-azabicyclo[3.1.0]hexane (PubChem CID 134956143) has the molecular formula C15H18INO3S and a molecular weight of 419.28 g/mol. Its IUPAC name is (1R,5S)-1-[(Z)-2-iodoethenyl]-4,4-dimethyl-3-(4-methylphenyl)sulfonyl-6-oxa-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-1-[(Z)-2-iodoethenyl]-4,4-dimethyl-3-(4-methylphenyl)sulfonyl-6-oxa-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 134956143 |
| Molecular Formula | C15H18INO3S |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | (1R,5S)-1-[(Z)-2-iodoethenyl]-4,4-dimethyl-3-(4-methylphenyl)sulfonyl-6-oxa-3-azabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@]3(/C=C\I)O[C@H]3C2(C)C)cc1 |
| InChI | InChI=1S/C15H18INO3S/c1-11-4-6-12(7-5-11)21(18,19)17-10-15(8-9-16)13(20-15)14(17,2)3/h4-9,13H,10H2,1-3H3/b9-8-/t13-,15+/m0/s1 |
| InChIKey | KRJFJCFBIGGVPS-YPSPLPASSA-N |
| XLogP | 2.86 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|