C34H64O5Si2 — CID 134957248
(Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12-pentamethyl-5-oxoheptadec-12-en-16-ynoic acid (PubChem CID 134957248) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is (Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12-pentamethyl-5-oxoheptadec-12-en-16-ynoic acid.
| Compound Name | (Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12-pentamethyl-5-oxoheptadec-12-en-16-ynoic acid |
|---|---|
| PubChem CID | 134957248 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | (Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8,12-pentamethyl-5-oxoheptadec-12-en-16-ynoic acid |
| SMILES | C#CCC/C=C(/C)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O5Si2/c1-17-18-19-21-25(2)22-20-23-26(3)30(39-41(15,16)33(8,9)10)27(4)31(37)34(11,12)28(24-29(35)36)38-40(13,14)32(5,6)7/h1,21,26-28,30H,18-20,22-24H2,2-16H3,(H,35,36)/b25-21-/t26-,27+,28-,30-/m0/s1 |
| InChIKey | XTHWYYXTMWTYDS-VJZVPUHUSA-N |
| XLogP | 9.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|