C26H29N3O4 — CID 134957711
tert-butyl N-[(1R,2R)-1,2-diphenyl-2-(pyridine-2-carbonylamino)ethyl]-N-methoxycarbamate (PubChem CID 134957711) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-1,2-diphenyl-2-(pyridine-2-carbonylamino)ethyl]-N-methoxycarbamate.
| Compound Name | tert-butyl N-[(1R,2R)-1,2-diphenyl-2-(pyridine-2-carbonylamino)ethyl]-N-methoxycarbamate |
|---|---|
| PubChem CID | 134957711 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | tert-butyl N-[(1R,2R)-1,2-diphenyl-2-(pyridine-2-carbonylamino)ethyl]-N-methoxycarbamate |
| SMILES | CON(C(=O)OC(C)(C)C)[C@H](c1ccccc1)[C@H](NC(=O)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O4/c1-26(2,3)33-25(31)29(32-4)23(20-15-9-6-10-16-20)22(19-13-7-5-8-14-19)28-24(30)21-17-11-12-18-27-21/h5-18,22-23H,1-4H3,(H,28,30)/t22-,23-/m1/s1 |
| InChIKey | WRSZHGYLOCNRIF-DHIUTWEWSA-N |
| XLogP | 5.09 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|