C18H16O3S — CID 134958564
2-(1,3-benzodioxol-5-ylsulfanyl)-1-phenylpent-4-en-1-one (PubChem CID 134958564) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfanyl)-1-phenylpent-4-en-1-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfanyl)-1-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 134958564 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfanyl)-1-phenylpent-4-en-1-one |
| SMILES | C=CCC(Sc1ccc2c(c1)OCO2)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16O3S/c1-2-6-17(18(19)13-7-4-3-5-8-13)22-14-9-10-15-16(11-14)21-12-20-15/h2-5,7-11,17H,1,6,12H2 |
| InChIKey | AHNSQNWOWMCITH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|