C17H27NO2Si — CID 134959204
[(E)-2-[dimethyl(phenyl)silyl]ethenyl] N,N-di(propan-2-yl)carbamate (PubChem CID 134959204) has the molecular formula C17H27NO2Si and a molecular weight of 305.49 g/mol. Its IUPAC name is [(E)-2-[dimethyl(phenyl)silyl]ethenyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E)-2-[dimethyl(phenyl)silyl]ethenyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 134959204 |
| Molecular Formula | C17H27NO2Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [(E)-2-[dimethyl(phenyl)silyl]ethenyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O/C=C/[Si](C)(C)c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H27NO2Si/c1-14(2)18(15(3)4)17(19)20-12-13-21(5,6)16-10-8-7-9-11-16/h7-15H,1-6H3/b13-12+ |
| InChIKey | KSGXUDLUHSDMPR-OUKQBFOZSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|