C22H24N2O5 — CID 134960523
dimethyl (1R,9Z,16S,18R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,9-tetraene-2,18-dicarboxylate (PubChem CID 134960523) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is dimethyl (1R,9Z,16S,18R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,9-tetraene-2,18-dicarboxylate.
| Compound Name | dimethyl (1R,9Z,16S,18R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,9-tetraene-2,18-dicarboxylate |
|---|---|
| PubChem CID | 134960523 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | dimethyl (1R,9Z,16S,18R)-13-oxo-2,12-diazapentacyclo[14.2.2.01,9.03,8.012,16]icosa-3,5,7,9-tetraene-2,18-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]23CCC(=O)N2C/C=C2/c4ccccc4N(C(=O)OC)[C@@]21CC3 |
| InChI | InChI=1S/C22H24N2O5/c1-28-19(26)16-13-21-9-7-18(25)23(21)12-8-15-14-5-3-4-6-17(14)24(20(27)29-2)22(15,16)11-10-21/h3-6,8,16H,7,9-13H2,1-2H3/b15-8-/t16-,21+,22-/m0/s1 |
| InChIKey | VEKBODKPORFDPA-JNNOIZRLSA-N |
| XLogP | 2.74 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |