C22H17NO4 — CID 134962641
(6aR,7S,12aR)-11-hydroxy-7-(4-hydroxyphenyl)-6a,7,12,12a-tetrahydrochromeno[4,3-b]quinolin-6-one (PubChem CID 134962641) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is (6aR,7S,12aR)-11-hydroxy-7-(4-hydroxyphenyl)-6a,7,12,12a-tetrahydrochromeno[4,3-b]quinolin-6-one.
| Compound Name | (6aR,7S,12aR)-11-hydroxy-7-(4-hydroxyphenyl)-6a,7,12,12a-tetrahydrochromeno[4,3-b]quinolin-6-one |
|---|---|
| PubChem CID | 134962641 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (6aR,7S,12aR)-11-hydroxy-7-(4-hydroxyphenyl)-6a,7,12,12a-tetrahydrochromeno[4,3-b]quinolin-6-one |
| SMILES | O=C1Oc2ccccc2[C@@H]2Nc3c(O)cccc3[C@H](c3ccc(O)cc3)[C@@H]12 |
| InChI | InChI=1S/C22H17NO4/c24-13-10-8-12(9-11-13)18-15-5-3-6-16(25)20(15)23-21-14-4-1-2-7-17(14)27-22(26)19(18)21/h1-11,18-19,21,23-25H/t18-,19+,21-/m0/s1 |
| InChIKey | YZYNMUQGVWBAKA-ZVDOUQERSA-N |
| XLogP | 3.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|