C27H21NO6 — CID 56601692
(3S,12S,13S)-13-(2,3-dimethoxyphenyl)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaene-11,22-dione (PubChem CID 56601692) has the molecular formula C27H21NO6 and a molecular weight of 455.47 g/mol. Its IUPAC name is (3S,12S,13S)-13-(2,3-dimethoxyphenyl)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaene-11,22-dione.
| Compound Name | (3S,12S,13S)-13-(2,3-dimethoxyphenyl)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaene-11,22-dione |
|---|---|
| PubChem CID | 56601692 |
| Molecular Formula | C27H21NO6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (3S,12S,13S)-13-(2,3-dimethoxyphenyl)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaene-11,22-dione |
| SMILES | COc1cccc([C@@H]2c3c(c(=O)oc4ccccc34)N[C@@H]3c4ccccc4OC(=O)[C@@H]23)c1OC |
| InChI | InChI=1S/C27H21NO6/c1-31-19-13-7-10-16(25(19)32-2)20-21-14-8-3-5-11-17(14)34-27(30)24(21)28-23-15-9-4-6-12-18(15)33-26(29)22(20)23/h3-13,20,22-23,28H,1-2H3/t20-,22+,23-/m1/s1 |
| InChIKey | JMEOEMKMBUEGLR-AKIFATBCSA-N |
| XLogP | 4.64 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|