C19H15NO3 — CID 56600910
(3S,12R)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaen-22-one (PubChem CID 56600910) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3S,12R)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaen-22-one.
| Compound Name | (3S,12R)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaen-22-one |
|---|---|
| PubChem CID | 56600910 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (3S,12R)-10,21-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),4,6,8,15,17,19-heptaen-22-one |
| SMILES | O=c1oc2ccccc2c2c1N[C@@H]1c3ccccc3OC[C@@H]1C2 |
| InChI | InChI=1S/C19H15NO3/c21-19-18-14(12-5-1-4-8-16(12)23-19)9-11-10-22-15-7-3-2-6-13(15)17(11)20-18/h1-8,11,17,20H,9-10H2/t11-,17-/m0/s1 |
| InChIKey | CIBZSJLTQCFHLQ-GTNSWQLSSA-N |
| XLogP | 3.51 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|