C21H21N4O3+ — CID 134962830
(1S,9R)-14-nitro-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11(16),12,14-pentaene (PubChem CID 134962830) has the molecular formula C21H21N4O3+ and a molecular weight of 377.42 g/mol. Its IUPAC name is (1S,9R)-14-nitro-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11(16),12,14-pentaene.
| Compound Name | (1S,9R)-14-nitro-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11(16),12,14-pentaene |
|---|---|
| PubChem CID | 134962830 |
| Molecular Formula | C21H21N4O3+ |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (1S,9R)-14-nitro-4-(2,4,6-trimethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11(16),12,14-pentaene |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)CO[C@@H]2Cc4ccc([N+](=O)[O-])cc4[C@@H]23)c(C)c1 |
| InChI | InChI=1S/C21H21N4O3/c1-12-6-13(2)20(14(3)7-12)24-11-23-19(22-24)10-28-18-8-15-4-5-16(25(26)27)9-17(15)21(18)23/h4-7,9,11,18,21H,8,10H2,1-3H3/q+1/t18-,21+/m1/s1 |
| InChIKey | XXXPADMCSLKHTK-NQIIRXRSSA-N |
| XLogP | 3.04 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|