C19H18N3O+ — CID 24759183
(1S,9R)-4-(2-methylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 24759183) has the molecular formula C19H18N3O+ and a molecular weight of 304.37 g/mol. Its IUPAC name is (1S,9R)-4-(2-methylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | (1S,9R)-4-(2-methylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 24759183 |
| Molecular Formula | C19H18N3O+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (1S,9R)-4-(2-methylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | Cc1ccccc1-n1c[n+]2c(n1)CO[C@@H]1Cc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C19H18N3O/c1-13-6-2-5-9-16(13)22-12-21-18(20-22)11-23-17-10-14-7-3-4-8-15(14)19(17)21/h2-9,12,17,19H,10-11H2,1H3/q+1/t17-,19+/m1/s1 |
| InChIKey | HHHOILFOPIKNEJ-MJGOQNOKSA-N |
| XLogP | 2.51 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|