C22H24N3O+ — CID 75144904
4-(2,6-diethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 75144904) has the molecular formula C22H24N3O+ and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-(2,6-diethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | 4-(2,6-diethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 75144904 |
| Molecular Formula | C22H24N3O+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-(2,6-diethylphenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | CCc1cccc(CC)c1-n1c[n+]2c(n1)COC1Cc3ccccc3C12 |
| InChI | InChI=1S/C22H24N3O/c1-3-15-9-7-10-16(4-2)21(15)25-14-24-20(23-25)13-26-19-12-17-8-5-6-11-18(17)22(19)24/h5-11,14,19,22H,3-4,12-13H2,1-2H3/q+1 |
| InChIKey | YSGCCGJTKPLKSB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|