C13H14N3O3S+ — CID 102293883
(1R,9S)-4-methylsulfonyl-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 102293883) has the molecular formula C13H14N3O3S+ and a molecular weight of 292.34 g/mol. Its IUPAC name is (1R,9S)-4-methylsulfonyl-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | (1R,9S)-4-methylsulfonyl-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 102293883 |
| Molecular Formula | C13H14N3O3S+ |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (1R,9S)-4-methylsulfonyl-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | CS(=O)(=O)n1c[n+]2c(n1)CO[C@H]1Cc3ccccc3[C@H]12 |
| InChI | InChI=1S/C13H14N3O3S/c1-20(17,18)16-8-15-12(14-16)7-19-11-6-9-4-2-3-5-10(9)13(11)15/h2-5,8,11,13H,6-7H2,1H3/q+1/t11-,13+/m0/s1 |
| InChIKey | CYBYKTJQHDVOBP-WCQYABFASA-N |
| XLogP | 0.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|