C18H13Br3N3O+ — CID 154707906
(1S,9R)-4-(2,4,6-tribromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 154707906) has the molecular formula C18H13Br3N3O+ and a molecular weight of 527.03 g/mol. Its IUPAC name is (1S,9R)-4-(2,4,6-tribromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | (1S,9R)-4-(2,4,6-tribromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 154707906 |
| Molecular Formula | C18H13Br3N3O+ |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 523.86 |
| IUPAC Name | (1S,9R)-4-(2,4,6-tribromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | Brc1cc(Br)c(-n2c[n+]3c(n2)CO[C@@H]2Cc4ccccc4[C@@H]23)c(Br)c1 |
| InChI | InChI=1S/C18H13Br3N3O/c19-11-6-13(20)18(14(21)7-11)24-9-23-16(22-24)8-25-15-5-10-3-1-2-4-12(10)17(15)23/h1-4,6-7,9,15,17H,5,8H2/q+1/t15-,17+/m1/s1 |
| InChIKey | QTUGLODSWNHFPF-WBVHZDCISA-N |
| XLogP | 4.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|