C18H15BrN3O+ — CID 164887371
(1S,9R)-4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene (PubChem CID 164887371) has the molecular formula C18H15BrN3O+ and a molecular weight of 369.24 g/mol. Its IUPAC name is (1S,9R)-4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene.
| Compound Name | (1S,9R)-4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
|---|---|
| PubChem CID | 164887371 |
| Molecular Formula | C18H15BrN3O+ |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (1S,9R)-4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene |
| SMILES | Brc1ccc(-n2c[n+]3c(n2)CO[C@@H]2Cc4ccccc4[C@@H]23)cc1 |
| InChI | InChI=1S/C18H15BrN3O/c19-13-5-7-14(8-6-13)22-11-21-17(20-22)10-23-16-9-12-3-1-2-4-15(12)18(16)21/h1-8,11,16,18H,9-10H2/q+1/t16-,18+/m1/s1 |
| InChIKey | AMUCCXSVCMFCQS-AEFFLSMTSA-N |
| XLogP | 2.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|