C26H23N3O3 — CID 134962899
(2S,3R)-2-ethyl-3-naphthalen-2-yl-4-nitro-1-(1-phenylimidazol-2-yl)pent-4-en-1-one (PubChem CID 134962899) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is (2S,3R)-2-ethyl-3-naphthalen-2-yl-4-nitro-1-(1-phenylimidazol-2-yl)pent-4-en-1-one.
| Compound Name | (2S,3R)-2-ethyl-3-naphthalen-2-yl-4-nitro-1-(1-phenylimidazol-2-yl)pent-4-en-1-one |
|---|---|
| PubChem CID | 134962899 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (2S,3R)-2-ethyl-3-naphthalen-2-yl-4-nitro-1-(1-phenylimidazol-2-yl)pent-4-en-1-one |
| SMILES | C=C([C@@H](c1ccc2ccccc2c1)[C@H](CC)C(=O)c1nccn1-c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C26H23N3O3/c1-3-23(25(30)26-27-15-16-28(26)22-11-5-4-6-12-22)24(18(2)29(31)32)21-14-13-19-9-7-8-10-20(19)17-21/h4-17,23-24H,2-3H2,1H3/t23-,24-/m0/s1 |
| InChIKey | QSZDMRGMQWVPOA-ZEQRLZLVSA-N |
| XLogP | 5.81 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|