C26H23N3O3S — CID 122392492
(2S,3S)-3-(4-methylphenyl)-4-nitro-1-(1-phenylimidazol-2-yl)-2-phenylsulfanylbutan-1-one (PubChem CID 122392492) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is (2S,3S)-3-(4-methylphenyl)-4-nitro-1-(1-phenylimidazol-2-yl)-2-phenylsulfanylbutan-1-one.
| Compound Name | (2S,3S)-3-(4-methylphenyl)-4-nitro-1-(1-phenylimidazol-2-yl)-2-phenylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 122392492 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (2S,3S)-3-(4-methylphenyl)-4-nitro-1-(1-phenylimidazol-2-yl)-2-phenylsulfanylbutan-1-one |
| SMILES | Cc1ccc([C@@H](C[N+](=O)[O-])[C@H](Sc2ccccc2)C(=O)c2nccn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O3S/c1-19-12-14-20(15-13-19)23(18-29(31)32)25(33-22-10-6-3-7-11-22)24(30)26-27-16-17-28(26)21-8-4-2-5-9-21/h2-17,23,25H,18H2,1H3/t23-,25+/m1/s1 |
| InChIKey | BNHJHTKRSQHQJB-NOZRDPDXSA-N |
| XLogP | 5.58 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|