C9H9BrO4 — CID 134963493
3-bromo-2-ethoxy-4,6-dihydroxybenzaldehyde (PubChem CID 134963493) has the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. Its IUPAC name is 3-bromo-2-ethoxy-4,6-dihydroxybenzaldehyde.
| Compound Name | 3-bromo-2-ethoxy-4,6-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 134963493 |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 3-bromo-2-ethoxy-4,6-dihydroxybenzaldehyde |
| SMILES | CCOc1c(Br)c(O)cc(O)c1C=O |
| InChI | InChI=1S/C9H9BrO4/c1-2-14-9-5(4-11)6(12)3-7(13)8(9)10/h3-4,12-13H,2H2,1H3 |
| InChIKey | XQRZSGVMHNLPSC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|