C12H15N3O2 — CID 134963732
3,4,5-trimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole (PubChem CID 134963732) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3,4,5-trimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole.
| Compound Name | 3,4,5-trimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 134963732 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3,4,5-trimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(C)C1C |
| InChI | InChI=1S/C12H15N3O2/c1-8-9(2)13-14(10(8)3)11-4-6-12(7-5-11)15(16)17/h4-8,10H,1-3H3 |
| InChIKey | AAXRUVURBNDWPL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|